C15H22N2O4 — CID 9353681
N-(butylcarbamoyl)-2-(4-ethoxyphenoxy)acetamide (PubChem CID 9353681) has the molecular formula C15H22N2O4 and a molecular weight of 294.35 g/mol. Its IUPAC name is N-(butylcarbamoyl)-2-(4-ethoxyphenoxy)acetamide.
| Compound Name | N-(butylcarbamoyl)-2-(4-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 9353681 |
| Molecular Formula | C15H22N2O4 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | N-(butylcarbamoyl)-2-(4-ethoxyphenoxy)acetamide |
| SMILES | CCCCNC(=O)NC(=O)COc1ccc(OCC)cc1 |
| InChI | InChI=1S/C15H22N2O4/c1-3-5-10-16-15(19)17-14(18)11-21-13-8-6-12(7-9-13)20-4-2/h6-9H,3-5,10-11H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | PFOBEIBVTRNDMK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|