C17H16N4OS — CID 935371
1-(3-methoxyphenyl)-3-(5-phenyl-1H-pyrazol-3-yl)thiourea (PubChem CID 935371) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-3-(5-phenyl-1H-pyrazol-3-yl)thiourea.
| Compound Name | 1-(3-methoxyphenyl)-3-(5-phenyl-1H-pyrazol-3-yl)thiourea |
|---|---|
| PubChem CID | 935371 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-(3-methoxyphenyl)-3-(5-phenyl-1H-pyrazol-3-yl)thiourea |
| SMILES | COc1cccc(NC(=S)Nc2cc(-c3ccccc3)[nH]n2)c1 |
| InChI | InChI=1S/C17H16N4OS/c1-22-14-9-5-8-13(10-14)18-17(23)19-16-11-15(20-21-16)12-6-3-2-4-7-12/h2-11H,1H3,(H3,18,19,20,21,23) |
| InChIKey | HUSNIQXJJLRWHH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|