C18H19Cl2NO4S — CID 9353867
N-[4-[[(1S)-2,2-dichlorocyclopropyl]methoxy]phenyl]-4-methoxy-N-methylbenzenesulfonamide (PubChem CID 9353867) has the molecular formula C18H19Cl2NO4S and a molecular weight of 416.33 g/mol. Its IUPAC name is N-[4-[[(1S)-2,2-dichlorocyclopropyl]methoxy]phenyl]-4-methoxy-N-methylbenzenesulfonamide.
| Compound Name | N-[4-[[(1S)-2,2-dichlorocyclopropyl]methoxy]phenyl]-4-methoxy-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 9353867 |
| Molecular Formula | C18H19Cl2NO4S |
| Molecular Weight | 416.33 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | N-[4-[[(1S)-2,2-dichlorocyclopropyl]methoxy]phenyl]-4-methoxy-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(OC[C@@H]3CC3(Cl)Cl)cc2)cc1 |
| InChI | InChI=1S/C18H19Cl2NO4S/c1-21(26(22,23)17-9-7-15(24-2)8-10-17)14-3-5-16(6-4-14)25-12-13-11-18(13,19)20/h3-10,13H,11-12H2,1-2H3/t13-/m0/s1 |
| InChIKey | PRCNYWLDRVPTFM-ZDUSSCGKSA-N |
| XLogP | 4.09 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.33 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|