C15H14ClNO5S — CID 100552922
2-chloro-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzoic acid (PubChem CID 100552922) has the molecular formula C15H14ClNO5S and a molecular weight of 355.80 g/mol. Its IUPAC name is 2-chloro-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzoic acid.
| Compound Name | 2-chloro-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzoic acid |
|---|---|
| PubChem CID | 100552922 |
| Molecular Formula | C15H14ClNO5S |
| Molecular Weight | 355.80 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 2-chloro-4-[(4-methoxyphenyl)sulfonyl-methylamino]benzoic acid |
| SMILES | COc1ccc(S(=O)(=O)N(C)c2ccc(C(=O)O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14ClNO5S/c1-17(10-3-8-13(15(18)19)14(16)9-10)23(20,21)12-6-4-11(22-2)5-7-12/h3-9H,1-2H3,(H,18,19) |
| InChIKey | IPFJFODZADIKBI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |