C18H20ClNO4S — CID 9354119
4-[3-[(2-chloro-5-methylphenoxy)methyl]phenyl]sulfonylmorpholine (PubChem CID 9354119) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is 4-[3-[(2-chloro-5-methylphenoxy)methyl]phenyl]sulfonylmorpholine.
| Compound Name | 4-[3-[(2-chloro-5-methylphenoxy)methyl]phenyl]sulfonylmorpholine |
|---|---|
| PubChem CID | 9354119 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 4-[3-[(2-chloro-5-methylphenoxy)methyl]phenyl]sulfonylmorpholine |
| SMILES | Cc1ccc(Cl)c(OCc2cccc(S(=O)(=O)N3CCOCC3)c2)c1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-14-5-6-17(19)18(11-14)24-13-15-3-2-4-16(12-15)25(21,22)20-7-9-23-10-8-20/h2-6,11-12H,7-10,13H2,1H3 |
| InChIKey | FUABHEQZMCIGPJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |