C17H17NO3 — CID 9354137
5-[(1S)-1-(3-nitrophenyl)ethoxy]-2,3-dihydro-1H-indene (PubChem CID 9354137) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 5-[(1S)-1-(3-nitrophenyl)ethoxy]-2,3-dihydro-1H-indene.
| Compound Name | 5-[(1S)-1-(3-nitrophenyl)ethoxy]-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 9354137 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-[(1S)-1-(3-nitrophenyl)ethoxy]-2,3-dihydro-1H-indene |
| SMILES | C[C@H](Oc1ccc2c(c1)CCC2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H17NO3/c1-12(14-5-3-7-16(10-14)18(19)20)21-17-9-8-13-4-2-6-15(13)11-17/h3,5,7-12H,2,4,6H2,1H3/t12-/m0/s1 |
| InChIKey | UWSPBTFYIGGCHA-LBPRGKRZSA-N |
| XLogP | 4.22 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|