C16H15BrN2O4S — CID 9354585
2-[(Z)-(2-bromophenyl)methylideneamino]oxy-N-(2-methylsulfonylphenyl)acetamide (PubChem CID 9354585) has the molecular formula C16H15BrN2O4S and a molecular weight of 411.28 g/mol. Its IUPAC name is 2-[(Z)-(2-bromophenyl)methylideneamino]oxy-N-(2-methylsulfonylphenyl)acetamide.
| Compound Name | 2-[(Z)-(2-bromophenyl)methylideneamino]oxy-N-(2-methylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 9354585 |
| Molecular Formula | C16H15BrN2O4S |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | 2-[(Z)-(2-bromophenyl)methylideneamino]oxy-N-(2-methylsulfonylphenyl)acetamide |
| SMILES | CS(=O)(=O)c1ccccc1NC(=O)CO/N=C\c1ccccc1Br |
| InChI | InChI=1S/C16H15BrN2O4S/c1-24(21,22)15-9-5-4-8-14(15)19-16(20)11-23-18-10-12-6-2-3-7-13(12)17/h2-10H,11H2,1H3,(H,19,20)/b18-10- |
| InChIKey | QMACWMFAXWRCOX-ZDLGFXPLSA-N |
| XLogP | 2.84 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|