C14H13ClN2O3 — CID 9354792
N-(2-chloro-4-methylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide (PubChem CID 9354792) has the molecular formula C14H13ClN2O3 and a molecular weight of 292.72 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 9354792 |
| Molecular Formula | C14H13ClN2O3 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide |
| SMILES | Cc1ccc(NC(=O)COc2cccc[n+]2[O-])c(Cl)c1 |
| InChI | InChI=1S/C14H13ClN2O3/c1-10-5-6-12(11(15)8-10)16-13(18)9-20-14-4-2-3-7-17(14)19/h2-8H,9H2,1H3,(H,16,18) |
| InChIKey | WPZBDOIQMVBXPU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|