C19H20N6OS2 — CID 9358063
N-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-1,3-thiazol-2-yl]-N-(2,3-dimethylphenyl)acetamide (PubChem CID 9358063) has the molecular formula C19H20N6OS2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-1,3-thiazol-2-yl]-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | N-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-1,3-thiazol-2-yl]-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 9358063 |
| Molecular Formula | C19H20N6OS2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | N-[4-[(Z)-(3-cyclopropyl-5-sulfanylidene-1H-1,2,4-triazol-4-yl)iminomethyl]-1,3-thiazol-2-yl]-N-(2,3-dimethylphenyl)acetamide |
| SMILES | CC(=O)N(c1nc(/C=N\n2c(C3CC3)n[nH]c2=S)cs1)c1cccc(C)c1C |
| InChI | InChI=1S/C19H20N6OS2/c1-11-5-4-6-16(12(11)2)24(13(3)26)19-21-15(10-28-19)9-20-25-17(14-7-8-14)22-23-18(25)27/h4-6,9-10,14H,7-8H2,1-3H3,(H,23,27)/b20-9- |
| InChIKey | YRHCMUZAOXZNFE-UKWGHVSLSA-N |
| XLogP | 4.46 |
| TPSA | 79.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|