C11H11Cl2N5O — CID 935984
2,5-dichloro-N-(1-propyltetrazol-5-yl)benzamide (PubChem CID 935984) has the molecular formula C11H11Cl2N5O and a molecular weight of 300.15 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-propyltetrazol-5-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(1-propyltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 935984 |
| Molecular Formula | C11H11Cl2N5O |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 2,5-dichloro-N-(1-propyltetrazol-5-yl)benzamide |
| SMILES | CCCn1nnnc1NC(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H11Cl2N5O/c1-2-5-18-11(15-16-17-18)14-10(19)8-6-7(12)3-4-9(8)13/h3-4,6H,2,5H2,1H3,(H,14,15,17,19) |
| InChIKey | YIUCKUJIFBHUKP-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |