C9H6Cl2N4O — CID 690470
2,5-dichloro-N-(1,2,4-triazol-4-yl)benzamide (PubChem CID 690470) has the molecular formula C9H6Cl2N4O and a molecular weight of 257.08 g/mol. Its IUPAC name is 2,5-dichloro-N-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | 2,5-dichloro-N-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 690470 |
| Molecular Formula | C9H6Cl2N4O |
| Molecular Weight | 257.08 g/mol |
| Exact Mass | 255.99 |
| IUPAC Name | 2,5-dichloro-N-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(Nn1cnnc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C9H6Cl2N4O/c10-6-1-2-8(11)7(3-6)9(16)14-15-4-12-13-5-15/h1-5H,(H,14,16) |
| InChIKey | KWXSWZPUOHUIJO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.08 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |