C11H10N2O2S — CID 9361752
3-cyano-6-cyclopropyl-2-methylsulfanylpyridine-4-carboxylic acid (PubChem CID 9361752) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 3-cyano-6-cyclopropyl-2-methylsulfanylpyridine-4-carboxylic acid.
| Compound Name | 3-cyano-6-cyclopropyl-2-methylsulfanylpyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 9361752 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 3-cyano-6-cyclopropyl-2-methylsulfanylpyridine-4-carboxylic acid |
| SMILES | CSc1nc(C2CC2)cc(C(=O)O)c1C#N |
| InChI | InChI=1S/C11H10N2O2S/c1-16-10-8(5-12)7(11(14)15)4-9(13-10)6-2-3-6/h4,6H,2-3H2,1H3,(H,14,15) |
| InChIKey | XWFRSQOPUQMYFX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |