C21H26N2O5S — CID 9361947
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate (PubChem CID 9361947) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 9361947 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[5-(1,3-benzodioxol-5-yl)-1,3,4-oxadiazol-2-yl]sulfanyl]acetate |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CSc1nnc(-c2ccc3c(c2)OCO3)o1 |
| InChI | InChI=1S/C21H26N2O5S/c1-12(2)15-6-4-13(3)8-17(15)27-19(24)10-29-21-23-22-20(28-21)14-5-7-16-18(9-14)26-11-25-16/h5,7,9,12-13,15,17H,4,6,8,10-11H2,1-3H3/t13-,15+,17-/m1/s1 |
| InChIKey | ZEZHPTQNXPMEAL-UKPHBRMFSA-N |
| XLogP | 4.56 |
| TPSA | 83.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |