C16H24N4O4S2 — CID 9365663
3-(3-methoxypropyl)-1-methyl-1-[(1-methylsulfonyl-2,3-dihydroindole-5-carbonyl)amino]thiourea (PubChem CID 9365663) has the molecular formula C16H24N4O4S2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 3-(3-methoxypropyl)-1-methyl-1-[(1-methylsulfonyl-2,3-dihydroindole-5-carbonyl)amino]thiourea.
| Compound Name | 3-(3-methoxypropyl)-1-methyl-1-[(1-methylsulfonyl-2,3-dihydroindole-5-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 9365663 |
| Molecular Formula | C16H24N4O4S2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 3-(3-methoxypropyl)-1-methyl-1-[(1-methylsulfonyl-2,3-dihydroindole-5-carbonyl)amino]thiourea |
| SMILES | COCCCNC(=S)N(C)NC(=O)c1ccc2c(c1)CCN2S(C)(=O)=O |
| InChI | InChI=1S/C16H24N4O4S2/c1-19(16(25)17-8-4-10-24-2)18-15(21)13-5-6-14-12(11-13)7-9-20(14)26(3,22)23/h5-6,11H,4,7-10H2,1-3H3,(H,17,25)(H,18,21) |
| InChIKey | LZOIKFFCXHXFNE-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|