C20H22N4O4 — CID 9367140
N'-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoyl]furan-2-carbohydrazide (PubChem CID 9367140) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is N'-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoyl]furan-2-carbohydrazide.
| Compound Name | N'-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoyl]furan-2-carbohydrazide |
|---|---|
| PubChem CID | 9367140 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | N'-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoyl]furan-2-carbohydrazide |
| SMILES | COc1cccc(-n2nc(C)c(CCC(=O)NNC(=O)c3ccco3)c2C)c1 |
| InChI | InChI=1S/C20H22N4O4/c1-13-17(9-10-19(25)21-22-20(26)18-8-5-11-28-18)14(2)24(23-13)15-6-4-7-16(12-15)27-3/h4-8,11-12H,9-10H2,1-3H3,(H,21,25)(H,22,26) |
| InChIKey | YXULOPXBLNJQPX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|