C20H29N5O2S — CID 9426041
1-tert-butyl-3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoylamino]thiourea (PubChem CID 9426041) has the molecular formula C20H29N5O2S and a molecular weight of 403.55 g/mol. Its IUPAC name is 1-tert-butyl-3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoylamino]thiourea.
| Compound Name | 1-tert-butyl-3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoylamino]thiourea |
|---|---|
| PubChem CID | 9426041 |
| Molecular Formula | C20H29N5O2S |
| Molecular Weight | 403.55 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 1-tert-butyl-3-[3-[1-(3-methoxyphenyl)-3,5-dimethylpyrazol-4-yl]propanoylamino]thiourea |
| SMILES | COc1cccc(-n2nc(C)c(CCC(=O)NNC(=S)NC(C)(C)C)c2C)c1 |
| InChI | InChI=1S/C20H29N5O2S/c1-13-17(10-11-18(26)22-23-19(28)21-20(3,4)5)14(2)25(24-13)15-8-7-9-16(12-15)27-6/h7-9,12H,10-11H2,1-6H3,(H,22,26)(H2,21,23,28) |
| InChIKey | CCEFPQAALVUDKW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 80.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|