C18H25N5OS — CID 9425924
1-tert-butyl-3-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]amino]thiourea (PubChem CID 9425924) has the molecular formula C18H25N5OS and a molecular weight of 359.50 g/mol. Its IUPAC name is 1-tert-butyl-3-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]amino]thiourea.
| Compound Name | 1-tert-butyl-3-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]amino]thiourea |
|---|---|
| PubChem CID | 9425924 |
| Molecular Formula | C18H25N5OS |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1-tert-butyl-3-[[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]amino]thiourea |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)NNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C18H25N5OS/c1-12-15(11-16(24)20-21-17(25)19-18(3,4)5)13(2)23(22-12)14-9-7-6-8-10-14/h6-10H,11H2,1-5H3,(H,20,24)(H2,19,21,25) |
| InChIKey | ATVCDZRXNRARBT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 70.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|