C24H23N5O2 — CID 9032199
N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-2-pyrrol-1-ylbenzohydrazide (PubChem CID 9032199) has the molecular formula C24H23N5O2 and a molecular weight of 413.48 g/mol. Its IUPAC name is N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-2-pyrrol-1-ylbenzohydrazide.
| Compound Name | N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-2-pyrrol-1-ylbenzohydrazide |
|---|---|
| PubChem CID | 9032199 |
| Molecular Formula | C24H23N5O2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | N'-[2-(3,5-dimethyl-1-phenylpyrazol-4-yl)acetyl]-2-pyrrol-1-ylbenzohydrazide |
| SMILES | Cc1nn(-c2ccccc2)c(C)c1CC(=O)NNC(=O)c1ccccc1-n1cccc1 |
| InChI | InChI=1S/C24H23N5O2/c1-17-21(18(2)29(27-17)19-10-4-3-5-11-19)16-23(30)25-26-24(31)20-12-6-7-13-22(20)28-14-8-9-15-28/h3-15H,16H2,1-2H3,(H,25,30)(H,26,31) |
| InChIKey | PVPRTEDYMMNVME-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|