C14H25N4O3S+ — CID 9374472
(2S)-N-(2-methoxyethyl)-2-[[5-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide (PubChem CID 9374472) has the molecular formula C14H25N4O3S+ and a molecular weight of 329.45 g/mol. Its IUPAC name is (2S)-N-(2-methoxyethyl)-2-[[5-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide.
| Compound Name | (2S)-N-(2-methoxyethyl)-2-[[5-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 9374472 |
| Molecular Formula | C14H25N4O3S+ |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2S)-N-(2-methoxyethyl)-2-[[5-(piperidin-1-ium-1-ylmethyl)-1,3,4-oxadiazol-2-yl]sulfanyl]propanamide |
| SMILES | COCCNC(=O)[C@H](C)Sc1nnc(C[NH+]2CCCCC2)o1 |
| InChI | InChI=1S/C14H24N4O3S/c1-11(13(19)15-6-9-20-2)22-14-17-16-12(21-14)10-18-7-4-3-5-8-18/h11H,3-10H2,1-2H3,(H,15,19)/p+1/t11-/m0/s1 |
| InChIKey | DIMZRXUPOTWGRR-NSHDSACASA-O |
| XLogP | -0.12 |
| TPSA | 81.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|