C16H26N5O2S+ — CID 9380002
N-acetyl-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 9380002) has the molecular formula C16H26N5O2S+ and a molecular weight of 352.48 g/mol. Its IUPAC name is N-acetyl-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-acetyl-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 9380002 |
| Molecular Formula | C16H26N5O2S+ |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-acetyl-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | C=CCn1c(CC[NH+]2CCCCC2)nnc1SCC(=O)NC(C)=O |
| InChI | InChI=1S/C16H25N5O2S/c1-3-8-21-14(7-11-20-9-5-4-6-10-20)18-19-16(21)24-12-15(23)17-13(2)22/h3H,1,4-12H2,2H3,(H,17,22,23)/p+1 |
| InChIKey | PDIPZWOFDNKZNJ-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 81.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|