C15H26N5OS+ — CID 9380014
(2R)-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide (PubChem CID 9380014) has the molecular formula C15H26N5OS+ and a molecular weight of 324.47 g/mol. Its IUPAC name is (2R)-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide.
| Compound Name | (2R)-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 9380014 |
| Molecular Formula | C15H26N5OS+ |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.19 |
| IUPAC Name | (2R)-2-[[5-(2-piperidin-1-ium-1-ylethyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]propanamide |
| SMILES | C=CCn1c(CC[NH+]2CCCCC2)nnc1S[C@H](C)C(N)=O |
| InChI | InChI=1S/C15H25N5OS/c1-3-8-20-13(7-11-19-9-5-4-6-10-19)17-18-15(20)22-12(2)14(16)21/h3,12H,1,4-11H2,2H3,(H2,16,21)/p+1/t12-/m1/s1 |
| InChIKey | QTXXMCXVZDFCPD-GFCCVEGCSA-O |
| XLogP | 0.04 |
| TPSA | 78.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|