C9H14N6O2S — CID 51727727
(2R)-2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-carbamoylpropanamide (PubChem CID 51727727) has the molecular formula C9H14N6O2S and a molecular weight of 270.32 g/mol. Its IUPAC name is (2R)-2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-carbamoylpropanamide.
| Compound Name | (2R)-2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 51727727 |
| Molecular Formula | C9H14N6O2S |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2R)-2-[(5-amino-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]-N-carbamoylpropanamide |
| SMILES | C=CCn1c(N)nnc1S[C@H](C)C(=O)NC(N)=O |
| InChI | InChI=1S/C9H14N6O2S/c1-3-4-15-7(10)13-14-9(15)18-5(2)6(16)12-8(11)17/h3,5H,1,4H2,2H3,(H2,10,13)(H3,11,12,16,17)/t5-/m1/s1 |
| InChIKey | RNPWBUUMOWEWQN-RXMQYKEDSA-N |
| XLogP | -0.28 |
| TPSA | 128.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|