C15H18N4O3S2 — CID 3954942
N-carbamoyl-2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide (PubChem CID 3954942) has the molecular formula C15H18N4O3S2 and a molecular weight of 366.47 g/mol. Its IUPAC name is N-carbamoyl-2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide.
| Compound Name | N-carbamoyl-2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
|---|---|
| PubChem CID | 3954942 |
| Molecular Formula | C15H18N4O3S2 |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | N-carbamoyl-2-(6-ethyl-4-oxo-3-prop-2-enylthieno[2,3-d]pyrimidin-2-yl)sulfanylpropanamide |
| SMILES | C=CCn1c(SC(C)C(=O)NC(N)=O)nc2sc(CC)cc2c1=O |
| InChI | InChI=1S/C15H18N4O3S2/c1-4-6-19-13(21)10-7-9(5-2)24-12(10)18-15(19)23-8(3)11(20)17-14(16)22/h4,7-8H,1,5-6H2,2-3H3,(H3,16,17,20,22) |
| InChIKey | GTQHLSPGIDESCA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|