C15H21N3O3S2 — CID 7739689
(2S)-2-[6-ethyl-3-(3-methoxypropyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide (PubChem CID 7739689) has the molecular formula C15H21N3O3S2 and a molecular weight of 355.49 g/mol. Its IUPAC name is (2S)-2-[6-ethyl-3-(3-methoxypropyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide.
| Compound Name | (2S)-2-[6-ethyl-3-(3-methoxypropyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide |
|---|---|
| PubChem CID | 7739689 |
| Molecular Formula | C15H21N3O3S2 |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (2S)-2-[6-ethyl-3-(3-methoxypropyl)-4-oxothieno[2,3-d]pyrimidin-2-yl]sulfanylpropanamide |
| SMILES | CCc1cc2c(=O)n(CCCOC)c(S[C@@H](C)C(N)=O)nc2s1 |
| InChI | InChI=1S/C15H21N3O3S2/c1-4-10-8-11-13(23-10)17-15(22-9(2)12(16)19)18(14(11)20)6-5-7-21-3/h8-9H,4-7H2,1-3H3,(H2,16,19)/t9-/m0/s1 |
| InChIKey | KVLMEHQKMDVBSP-VIFPVBQESA-N |
| XLogP | 2.02 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|