C24H26N4O3 — CID 9380664
[2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate (PubChem CID 9380664) has the molecular formula C24H26N4O3 and a molecular weight of 418.50 g/mol. Its IUPAC name is [2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate.
| Compound Name | [2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 9380664 |
| Molecular Formula | C24H26N4O3 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | [2-(3-methyl-4-pyrrolidin-1-ylanilino)-2-oxoethyl] 4-(5-methylpyrazol-1-yl)benzoate |
| SMILES | Cc1cc(NC(=O)COC(=O)c2ccc(-n3nccc3C)cc2)ccc1N1CCCC1 |
| InChI | InChI=1S/C24H26N4O3/c1-17-15-20(7-10-22(17)27-13-3-4-14-27)26-23(29)16-31-24(30)19-5-8-21(9-6-19)28-18(2)11-12-25-28/h5-12,15H,3-4,13-14,16H2,1-2H3,(H,26,29) |
| InChIKey | RSSIKEJNAIMKOI-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|