C18H17FN2O4S — CID 9380988
1-[(2S)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-2-(3-methyl-4-nitrophenoxy)ethanone (PubChem CID 9380988) has the molecular formula C18H17FN2O4S and a molecular weight of 376.41 g/mol. Its IUPAC name is 1-[(2S)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-2-(3-methyl-4-nitrophenoxy)ethanone.
| Compound Name | 1-[(2S)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-2-(3-methyl-4-nitrophenoxy)ethanone |
|---|---|
| PubChem CID | 9380988 |
| Molecular Formula | C18H17FN2O4S |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 1-[(2S)-2-(2-fluorophenyl)-1,3-thiazolidin-3-yl]-2-(3-methyl-4-nitrophenoxy)ethanone |
| SMILES | Cc1cc(OCC(=O)N2CCS[C@H]2c2ccccc2F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H17FN2O4S/c1-12-10-13(6-7-16(12)21(23)24)25-11-17(22)20-8-9-26-18(20)14-4-2-3-5-15(14)19/h2-7,10,18H,8-9,11H2,1H3/t18-/m0/s1 |
| InChIKey | JXZDOKULODGNLR-SFHVURJKSA-N |
| XLogP | 3.70 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|