C17H14N4O2 — CID 938408
7-methoxy-3-(pyridin-2-ylmethyl)-5H-pyrimido[5,4-b]indol-4-one (PubChem CID 938408) has the molecular formula C17H14N4O2 and a molecular weight of 306.33 g/mol. Its IUPAC name is 7-methoxy-3-(pyridin-2-ylmethyl)-5H-pyrimido[5,4-b]indol-4-one.
| Compound Name | 7-methoxy-3-(pyridin-2-ylmethyl)-5H-pyrimido[5,4-b]indol-4-one |
|---|---|
| PubChem CID | 938408 |
| Molecular Formula | C17H14N4O2 |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 7-methoxy-3-(pyridin-2-ylmethyl)-5H-pyrimido[5,4-b]indol-4-one |
| SMILES | COc1ccc2c(c1)[nH]c1c(=O)n(Cc3ccccn3)cnc12 |
| InChI | InChI=1S/C17H14N4O2/c1-23-12-5-6-13-14(8-12)20-16-15(13)19-10-21(17(16)22)9-11-4-2-3-7-18-11/h2-8,10,20H,9H2,1H3 |
| InChIKey | XZXITGRMINMVAH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |