C17H16F2N2O4S — CID 9384202
(2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(3-methyl-4-nitrophenoxy)propanamide (PubChem CID 9384202) has the molecular formula C17H16F2N2O4S and a molecular weight of 382.39 g/mol. Its IUPAC name is (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(3-methyl-4-nitrophenoxy)propanamide.
| Compound Name | (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(3-methyl-4-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 9384202 |
| Molecular Formula | C17H16F2N2O4S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | (2S)-N-[4-(difluoromethylsulfanyl)phenyl]-2-(3-methyl-4-nitrophenoxy)propanamide |
| SMILES | Cc1cc(O[C@@H](C)C(=O)Nc2ccc(SC(F)F)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16F2N2O4S/c1-10-9-13(5-8-15(10)21(23)24)25-11(2)16(22)20-12-3-6-14(7-4-12)26-17(18)19/h3-9,11,17H,1-2H3,(H,20,22)/t11-/m0/s1 |
| InChIKey | SGICUZNUEUZFNL-NSHDSACASA-N |
| XLogP | 4.62 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|