C18H17F2NO4S — CID 8639929
methyl 3-[(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl]oxybenzoate (PubChem CID 8639929) has the molecular formula C18H17F2NO4S and a molecular weight of 381.40 g/mol. Its IUPAC name is methyl 3-[(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl]oxybenzoate.
| Compound Name | methyl 3-[(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl]oxybenzoate |
|---|---|
| PubChem CID | 8639929 |
| Molecular Formula | C18H17F2NO4S |
| Molecular Weight | 381.40 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | methyl 3-[(2R)-1-[4-(difluoromethylsulfanyl)anilino]-1-oxopropan-2-yl]oxybenzoate |
| SMILES | COC(=O)c1cccc(O[C@H](C)C(=O)Nc2ccc(SC(F)F)cc2)c1 |
| InChI | InChI=1S/C18H17F2NO4S/c1-11(25-14-5-3-4-12(10-14)17(23)24-2)16(22)21-13-6-8-15(9-7-13)26-18(19)20/h3-11,18H,1-2H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | DLXAQSIQBPDQIL-LLVKDONJSA-N |
| XLogP | 4.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.40 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |