C12H16N2O4 — CID 9386239
[(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9386239) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9386239 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | CCNC(=O)[C@@H](C)OC(=O)c1cc(C(C)=O)c[nH]1 |
| InChI | InChI=1S/C12H16N2O4/c1-4-13-11(16)8(3)18-12(17)10-5-9(6-14-10)7(2)15/h5-6,8,14H,4H2,1-3H3,(H,13,16)/t8-/m1/s1 |
| InChIKey | DGRSIKNGPHIBMQ-MRVPVSSYSA-N |
| XLogP | 0.90 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |