C16H13F3N2O4 — CID 9385826
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate (PubChem CID 9385826) has the molecular formula C16H13F3N2O4 and a molecular weight of 354.28 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 9385826 |
| Molecular Formula | C16H13F3N2O4 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 4-acetyl-1H-pyrrole-2-carboxylate |
| SMILES | CC(=O)c1c[nH]c(C(=O)O[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H13F3N2O4/c1-7(22)9-5-12(20-6-9)16(24)25-8(2)15(23)21-11-4-3-10(17)13(18)14(11)19/h3-6,8,20H,1-2H3,(H,21,23)/t8-/m0/s1 |
| InChIKey | VZEVDYNLGZFATC-QMMMGPOBSA-N |
| XLogP | 2.82 |
| TPSA | 88.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|