C21H21N3O5 — CID 9399863
(3R)-N'-(1,3-benzodioxole-5-carbonyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 9399863) has the molecular formula C21H21N3O5 and a molecular weight of 395.42 g/mol. Its IUPAC name is (3R)-N'-(1,3-benzodioxole-5-carbonyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | (3R)-N'-(1,3-benzodioxole-5-carbonyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 9399863 |
| Molecular Formula | C21H21N3O5 |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3R)-N'-(1,3-benzodioxole-5-carbonyl)-1-(4-ethylphenyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CCc1ccc(N2C[C@H](C(=O)NNC(=O)c3ccc4c(c3)OCO4)CC2=O)cc1 |
| InChI | InChI=1S/C21H21N3O5/c1-2-13-3-6-16(7-4-13)24-11-15(10-19(24)25)21(27)23-22-20(26)14-5-8-17-18(9-14)29-12-28-17/h3-9,15H,2,10-12H2,1H3,(H,22,26)(H,23,27)/t15-/m1/s1 |
| InChIKey | DMVCUFIPJVJDTA-OAHLLOKOSA-N |
| XLogP | 1.79 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|