C23H25N3O5 — CID 47024185
1-(1,3-benzodioxol-5-yl)-N'-(4-tert-butylbenzoyl)-5-oxopyrrolidine-3-carbohydrazide (PubChem CID 47024185) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-N'-(4-tert-butylbenzoyl)-5-oxopyrrolidine-3-carbohydrazide.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-N'-(4-tert-butylbenzoyl)-5-oxopyrrolidine-3-carbohydrazide |
|---|---|
| PubChem CID | 47024185 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-N'-(4-tert-butylbenzoyl)-5-oxopyrrolidine-3-carbohydrazide |
| SMILES | CC(C)(C)c1ccc(C(=O)NNC(=O)C2CC(=O)N(c3ccc4c(c3)OCO4)C2)cc1 |
| InChI | InChI=1S/C23H25N3O5/c1-23(2,3)16-6-4-14(5-7-16)21(28)24-25-22(29)15-10-20(27)26(12-15)17-8-9-18-19(11-17)31-13-30-18/h4-9,11,15H,10,12-13H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | PZVQWGAKXNSVMB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|