C25H30N4O4 — CID 94009810
(3R)-N-(2,4-dimethoxyphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide (PubChem CID 94009810) has the molecular formula C25H30N4O4 and a molecular weight of 450.54 g/mol. Its IUPAC name is (3R)-N-(2,4-dimethoxyphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-(2,4-dimethoxyphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 94009810 |
| Molecular Formula | C25H30N4O4 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | (3R)-N-(2,4-dimethoxyphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide |
| SMILES | CCCOc1nc2ccccc2nc1N1CCC[C@@H](C(=O)Nc2ccc(OC)cc2OC)C1 |
| InChI | InChI=1S/C25H30N4O4/c1-4-14-33-25-23(26-19-9-5-6-10-20(19)28-25)29-13-7-8-17(16-29)24(30)27-21-12-11-18(31-2)15-22(21)32-3/h5-6,9-12,15,17H,4,7-8,13-14,16H2,1-3H3,(H,27,30)/t17-/m1/s1 |
| InChIKey | WGEBVUSBDREZLC-QGZVFWFLSA-N |
| XLogP | 4.29 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |