C25H30N4O2 — CID 50752918
N-(2-ethylphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide (PubChem CID 50752918) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-(2-ethylphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide.
| Compound Name | N-(2-ethylphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 50752918 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | N-(2-ethylphenyl)-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide |
| SMILES | CCCOc1nc2ccccc2nc1N1CCCC(C(=O)Nc2ccccc2CC)C1 |
| InChI | InChI=1S/C25H30N4O2/c1-3-16-31-25-23(26-21-13-7-8-14-22(21)28-25)29-15-9-11-19(17-29)24(30)27-20-12-6-5-10-18(20)4-2/h5-8,10,12-14,19H,3-4,9,11,15-17H2,1-2H3,(H,27,30) |
| InChIKey | OSEUMZIEMOSSJE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |