C22H30N4O3 — CID 129420371
(3R)-N-[[(2R)-oxolan-2-yl]methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide (PubChem CID 129420371) has the molecular formula C22H30N4O3 and a molecular weight of 398.51 g/mol. Its IUPAC name is (3R)-N-[[(2R)-oxolan-2-yl]methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-[[(2R)-oxolan-2-yl]methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 129420371 |
| Molecular Formula | C22H30N4O3 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | (3R)-N-[[(2R)-oxolan-2-yl]methyl]-1-(3-propoxyquinoxalin-2-yl)piperidine-3-carboxamide |
| SMILES | CCCOc1nc2ccccc2nc1N1CCC[C@@H](C(=O)NC[C@H]2CCCO2)C1 |
| InChI | InChI=1S/C22H30N4O3/c1-2-12-29-22-20(24-18-9-3-4-10-19(18)25-22)26-11-5-7-16(15-26)21(27)23-14-17-8-6-13-28-17/h3-4,9-10,16-17H,2,5-8,11-15H2,1H3,(H,23,27)/t16-,17-/m1/s1 |
| InChIKey | PIMVUOWYDYAGLE-IAGOWNOFSA-N |
| XLogP | 2.93 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |