C28H33N3O4S — CID 94013317
4-tert-butyl-N-[3-[[(2S)-2-(N-methylsulfonylanilino)butanoyl]amino]phenyl]benzamide (PubChem CID 94013317) has the molecular formula C28H33N3O4S and a molecular weight of 507.66 g/mol. Its IUPAC name is 4-tert-butyl-N-[3-[[(2S)-2-(N-methylsulfonylanilino)butanoyl]amino]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[3-[[(2S)-2-(N-methylsulfonylanilino)butanoyl]amino]phenyl]benzamide |
|---|---|
| PubChem CID | 94013317 |
| Molecular Formula | C28H33N3O4S |
| Molecular Weight | 507.66 g/mol |
| Exact Mass | 507.22 |
| IUPAC Name | 4-tert-butyl-N-[3-[[(2S)-2-(N-methylsulfonylanilino)butanoyl]amino]phenyl]benzamide |
| SMILES | CC[C@@H](C(=O)Nc1cccc(NC(=O)c2ccc(C(C)(C)C)cc2)c1)N(c1ccccc1)S(C)(=O)=O |
| InChI | InChI=1S/C28H33N3O4S/c1-6-25(31(36(5,34)35)24-13-8-7-9-14-24)27(33)30-23-12-10-11-22(19-23)29-26(32)20-15-17-21(18-16-20)28(2,3)4/h7-19,25H,6H2,1-5H3,(H,29,32)(H,30,33)/t25-/m0/s1 |
| InChIKey | KAQTXTCOKGRGCC-VWLOTQADSA-N |
| XLogP | 5.42 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |