C19H23ClN2O3S — CID 132660103
N-(3-chlorophenyl)-2-(3,5-dimethyl-N-methylsulfonylanilino)butanamide (PubChem CID 132660103) has the molecular formula C19H23ClN2O3S and a molecular weight of 394.92 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(3,5-dimethyl-N-methylsulfonylanilino)butanamide.
| Compound Name | N-(3-chlorophenyl)-2-(3,5-dimethyl-N-methylsulfonylanilino)butanamide |
|---|---|
| PubChem CID | 132660103 |
| Molecular Formula | C19H23ClN2O3S |
| Molecular Weight | 394.92 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | N-(3-chlorophenyl)-2-(3,5-dimethyl-N-methylsulfonylanilino)butanamide |
| SMILES | CCC(C(=O)Nc1cccc(Cl)c1)N(c1cc(C)cc(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C19H23ClN2O3S/c1-5-18(19(23)21-16-8-6-7-15(20)12-16)22(26(4,24)25)17-10-13(2)9-14(3)11-17/h6-12,18H,5H2,1-4H3,(H,21,23) |
| InChIKey | OOYXUDVBIZNEQL-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.92 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |