C22H28N2O4S — CID 132665009
2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)butanamide (PubChem CID 132665009) has the molecular formula C22H28N2O4S and a molecular weight of 416.54 g/mol. Its IUPAC name is 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)butanamide.
| Compound Name | 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)butanamide |
|---|---|
| PubChem CID | 132665009 |
| Molecular Formula | C22H28N2O4S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 2-(3,5-dimethyl-N-methylsulfonylanilino)-N-(3-prop-2-enoxyphenyl)butanamide |
| SMILES | C=CCOc1cccc(NC(=O)C(CC)N(c2cc(C)cc(C)c2)S(C)(=O)=O)c1 |
| InChI | InChI=1S/C22H28N2O4S/c1-6-11-28-20-10-8-9-18(15-20)23-22(25)21(7-2)24(29(5,26)27)19-13-16(3)12-17(4)14-19/h6,8-10,12-15,21H,1,7,11H2,2-5H3,(H,23,25) |
| InChIKey | SBEMJEGWYCLUAI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|