C21H26N2O5S — CID 132665628
methyl 4-[2-(3,5-dimethyl-N-methylsulfonylanilino)butanoylamino]benzoate (PubChem CID 132665628) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is methyl 4-[2-(3,5-dimethyl-N-methylsulfonylanilino)butanoylamino]benzoate.
| Compound Name | methyl 4-[2-(3,5-dimethyl-N-methylsulfonylanilino)butanoylamino]benzoate |
|---|---|
| PubChem CID | 132665628 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | methyl 4-[2-(3,5-dimethyl-N-methylsulfonylanilino)butanoylamino]benzoate |
| SMILES | CCC(C(=O)Nc1ccc(C(=O)OC)cc1)N(c1cc(C)cc(C)c1)S(C)(=O)=O |
| InChI | InChI=1S/C21H26N2O5S/c1-6-19(20(24)22-17-9-7-16(8-10-17)21(25)28-4)23(29(5,26)27)18-12-14(2)11-15(3)13-18/h7-13,19H,6H2,1-5H3,(H,22,24) |
| InChIKey | FRGXIWVBJZYPAD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |