C23H29FN2O2 — CID 94015582
(2S)-2-(2-fluorophenoxy)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide (PubChem CID 94015582) has the molecular formula C23H29FN2O2 and a molecular weight of 384.50 g/mol. Its IUPAC name is (2S)-2-(2-fluorophenoxy)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide.
| Compound Name | (2S)-2-(2-fluorophenoxy)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 94015582 |
| Molecular Formula | C23H29FN2O2 |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (2S)-2-(2-fluorophenoxy)-N-[[4-(piperidin-1-ylmethyl)phenyl]methyl]butanamide |
| SMILES | CC[C@H](Oc1ccccc1F)C(=O)NCc1ccc(CN2CCCCC2)cc1 |
| InChI | InChI=1S/C23H29FN2O2/c1-2-21(28-22-9-5-4-8-20(22)24)23(27)25-16-18-10-12-19(13-11-18)17-26-14-6-3-7-15-26/h4-5,8-13,21H,2-3,6-7,14-17H2,1H3,(H,25,27)/t21-/m0/s1 |
| InChIKey | MFKZOBRHAWUSTA-NRFANRHFSA-N |
| XLogP | 4.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |