C21H27NOS — CID 94019796
N-[(1R)-3-methyl-1-phenylbutyl]-2-[(2-methylphenyl)methylsulfanyl]acetamide (PubChem CID 94019796) has the molecular formula C21H27NOS and a molecular weight of 341.52 g/mol. Its IUPAC name is N-[(1R)-3-methyl-1-phenylbutyl]-2-[(2-methylphenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(1R)-3-methyl-1-phenylbutyl]-2-[(2-methylphenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 94019796 |
| Molecular Formula | C21H27NOS |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[(1R)-3-methyl-1-phenylbutyl]-2-[(2-methylphenyl)methylsulfanyl]acetamide |
| SMILES | Cc1ccccc1CSCC(=O)N[C@H](CC(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H27NOS/c1-16(2)13-20(18-10-5-4-6-11-18)22-21(23)15-24-14-19-12-8-7-9-17(19)3/h4-12,16,20H,13-15H2,1-3H3,(H,22,23)/t20-/m1/s1 |
| InChIKey | VGQZEKFWJBKYRK-HXUWFJFHSA-N |
| XLogP | 5.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |