C13H18N4OS — CID 94021120
N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-pyrazol-1-ylacetamide (PubChem CID 94021120) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-pyrazol-1-ylacetamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-pyrazol-1-ylacetamide |
|---|---|
| PubChem CID | 94021120 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-thiophen-3-ylethyl]-2-pyrazol-1-ylacetamide |
| SMILES | CN(C)[C@@H](CNC(=O)Cn1cccn1)c1ccsc1 |
| InChI | InChI=1S/C13H18N4OS/c1-16(2)12(11-4-7-19-10-11)8-14-13(18)9-17-6-3-5-15-17/h3-7,10,12H,8-9H2,1-2H3,(H,14,18)/t12-/m0/s1 |
| InChIKey | AWZRPHYZOWCHNG-LBPRGKRZSA-N |
| XLogP | 1.36 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |