C16H16FN5O2 — CID 94023245
(4S)-7-fluoro-2-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 94023245) has the molecular formula C16H16FN5O2 and a molecular weight of 329.34 g/mol. Its IUPAC name is (4S)-7-fluoro-2-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | (4S)-7-fluoro-2-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 94023245 |
| Molecular Formula | C16H16FN5O2 |
| Molecular Weight | 329.34 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (4S)-7-fluoro-2-oxo-N-[2-(pyrimidin-2-ylamino)ethyl]-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | O=C1C[C@H](C(=O)NCCNc2ncccn2)c2ccc(F)cc2N1 |
| InChI | InChI=1S/C16H16FN5O2/c17-10-2-3-11-12(9-14(23)22-13(11)8-10)15(24)18-6-7-21-16-19-4-1-5-20-16/h1-5,8,12H,6-7,9H2,(H,18,24)(H,22,23)(H,19,20,21)/t12-/m0/s1 |
| InChIKey | XRRHSDYEXPXSKP-LBPRGKRZSA-N |
| XLogP | 1.27 |
| TPSA | 96.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|