C20H29FN4O2 — CID 86985115
N-[4-(4-ethylpiperazin-1-yl)butyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide (PubChem CID 86985115) has the molecular formula C20H29FN4O2 and a molecular weight of 376.48 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)butyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 86985115 |
| Molecular Formula | C20H29FN4O2 |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)butyl]-7-fluoro-2-oxo-3,4-dihydro-1H-quinoline-4-carboxamide |
| SMILES | CCN1CCN(CCCCNC(=O)C2CC(=O)Nc3cc(F)ccc32)CC1 |
| InChI | InChI=1S/C20H29FN4O2/c1-2-24-9-11-25(12-10-24)8-4-3-7-22-20(27)17-14-19(26)23-18-13-15(21)5-6-16(17)18/h5-6,13,17H,2-4,7-12,14H2,1H3,(H,22,27)(H,23,26) |
| InChIKey | ASVLMRBULZQKJP-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|