C13H14ClN3O2S — CID 94023467
N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 94023467) has the molecular formula C13H14ClN3O2S and a molecular weight of 311.79 g/mol. Its IUPAC name is N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 94023467 |
| Molecular Formula | C13H14ClN3O2S |
| Molecular Weight | 311.79 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | N-[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NC[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C13H14ClN3O2S/c1-2-10-12(20-17-16-10)13(19)15-7-11(18)8-4-3-5-9(14)6-8/h3-6,11,18H,2,7H2,1H3,(H,15,19)/t11-/m0/s1 |
| InChIKey | KZHGLXKJBRRAGS-NSHDSACASA-N |
| XLogP | 2.22 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.79 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |