C17H24N4OS — CID 51864652
N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide (PubChem CID 51864652) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 51864652 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1ccc([C@H](CNC(=O)c2snnc2CC)N(C)C)cc1 |
| InChI | InChI=1S/C17H24N4OS/c1-5-12-7-9-13(10-8-12)15(21(3)4)11-18-17(22)16-14(6-2)19-20-23-16/h7-10,15H,5-6,11H2,1-4H3,(H,18,22)/t15-/m0/s1 |
| InChIKey | WJKAMGADMZLTME-HNNXBMFYSA-N |
| XLogP | 2.70 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |