C17H21BrN2OS — CID 46578078
5-bromo-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-3-carboxamide (PubChem CID 46578078) has the molecular formula C17H21BrN2OS and a molecular weight of 381.34 g/mol. Its IUPAC name is 5-bromo-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-3-carboxamide.
| Compound Name | 5-bromo-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 46578078 |
| Molecular Formula | C17H21BrN2OS |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | 5-bromo-N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]thiophene-3-carboxamide |
| SMILES | CCc1ccc(C(CNC(=O)c2csc(Br)c2)N(C)C)cc1 |
| InChI | InChI=1S/C17H21BrN2OS/c1-4-12-5-7-13(8-6-12)15(20(2)3)10-19-17(21)14-9-16(18)22-11-14/h5-9,11,15H,4,10H2,1-3H3,(H,19,21) |
| InChIKey | ZTLKIYBZBNITLL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |