C21H28N2OS — CID 43045032
N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(methylsulfanylmethyl)benzamide (PubChem CID 43045032) has the molecular formula C21H28N2OS and a molecular weight of 356.54 g/mol. Its IUPAC name is N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(methylsulfanylmethyl)benzamide.
| Compound Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(methylsulfanylmethyl)benzamide |
|---|---|
| PubChem CID | 43045032 |
| Molecular Formula | C21H28N2OS |
| Molecular Weight | 356.54 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | N-[2-(dimethylamino)-2-(4-ethylphenyl)ethyl]-3-(methylsulfanylmethyl)benzamide |
| SMILES | CCc1ccc(C(CNC(=O)c2cccc(CSC)c2)N(C)C)cc1 |
| InChI | InChI=1S/C21H28N2OS/c1-5-16-9-11-18(12-10-16)20(23(2)3)14-22-21(24)19-8-6-7-17(13-19)15-25-4/h6-13,20H,5,14-15H2,1-4H3,(H,22,24) |
| InChIKey | YKIKUVXCZZIHCH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |