C12H20BrN3OS — CID 106288343
N-(2-bromo-3-ethylpentyl)-4-ethylthiadiazole-5-carboxamide (PubChem CID 106288343) has the molecular formula C12H20BrN3OS and a molecular weight of 334.28 g/mol. Its IUPAC name is N-(2-bromo-3-ethylpentyl)-4-ethylthiadiazole-5-carboxamide.
| Compound Name | N-(2-bromo-3-ethylpentyl)-4-ethylthiadiazole-5-carboxamide |
|---|---|
| PubChem CID | 106288343 |
| Molecular Formula | C12H20BrN3OS |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.05 |
| IUPAC Name | N-(2-bromo-3-ethylpentyl)-4-ethylthiadiazole-5-carboxamide |
| SMILES | CCc1nnsc1C(=O)NCC(Br)C(CC)CC |
| InChI | InChI=1S/C12H20BrN3OS/c1-4-8(5-2)9(13)7-14-12(17)11-10(6-3)15-16-18-11/h8-9H,4-7H2,1-3H3,(H,14,17) |
| InChIKey | UBRNYXWJGCBTJP-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|